For research use only. Not for therapeutic Use.
Moclobemide-d4(Cat No.:S000500) is a deuterated form of moclobemide, where four hydrogen atoms are replaced with deuterium. Moclobemide is a reversible inhibitor of monoamine oxidase A (MAO-A), used primarily as an antidepressant in the treatment of major depressive disorder. The introduction of deuterium in moclobemide-d4 increases its metabolic stability, making it particularly useful for detailed pharmacokinetic studies. This enhanced stability allows researchers to more accurately track how moclobemide is metabolized in the body, leading to a better understanding of its pharmacodynamics, optimizing therapeutic dosages, and minimizing side effects for improved patient care.
Catalog Number | S000500 |
CAS Number | 2929883-33-8 |
Molecular Formula | C13H13D4ClN2O2 |
Purity | ≥95% |
Target | Monoamine Oxidase |
IUPAC Name | 4-chloro-2,3,5,6-tetradeuterio-N-(2-morpholin-4-ylethyl)benzamide |
InChI | InChI=1S/C13H17ClN2O2/c14-12-3-1-11(2-4-12)13(17)15-5-6-16-7-9-18-10-8-16/h1-4H,5-10H2,(H,15,17)/i1D,2D,3D,4D |
InChIKey | YHXISWVBGDMDLQ-RHQRLBAQSA-N |
SMILES | C1COCCN1CCNC(=O)C2=CC=C(C=C2)Cl |