For research use only. Not for therapeutic Use.
Monascorubrin(Cat No.:M059507)is a high-purity azaphilone pigment derived from Monascus species, widely used in natural product and pharmaceutical research. Known for its antimicrobial, antioxidant, and anticancer properties, it plays a crucial role in studying cellular mechanisms and therapeutic potential. Monascorubrin is also explored for its applications in food science as a natural colorant and bioactive compound. Its unique chemical structure and bioactivity make it valuable for investigating secondary metabolites and their applications in health and industry.
CAS Number | 13283-90-4 |
Molecular Formula | C23H26O5 |
Purity | ≥95% |
Target | Antibiotic |
Storage | Store at -20°C |
IUPAC Name | (9aR)-9a-methyl-3-octanoyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione |
InChI | InChI=1S/C23H26O5/c1-4-6-7-8-9-11-19(24)20-18-13-15-12-16(10-5-2)27-14-17(15)21(25)23(18,3)28-22(20)26/h5,10,12-14H,4,6-9,11H2,1-3H3/b10-5+/t23-/m1/s1 |
InChIKey | IIPVSGPTPPURBD-HAOIVFDCSA-N |
SMILES | CCCCCCCC(=O)C1=C2C=C3C=C(OC=C3C(=O)[C@@]2(OC1=O)C)/C=C/C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |