For research use only. Not for therapeutic Use.
Mono(2-heptyl) phthalate (Cat.No:R023048) is a chemical compound used as a plasticizer in various applications. It enhances the flexibility and durability of plastics, making it valuable in manufacturing. However, its potential environmental and health concerns have prompted regulatory scrutiny and the exploration of safer alternatives in plastic production.
| Catalog Number | R023048 |
| CAS Number | 129171-03-5 |
| Synonyms | 1,2-Benzenedicarboxylic Acid 1-(1-Methylhexyl) Ester; |
| Molecular Formula | C15H20O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-heptan-2-yloxycarbonylbenzoic acid |
| InChI | InChI=1S/C15H20O4/c1-3-4-5-8-11(2)19-15(18)13-10-7-6-9-12(13)14(16)17/h6-7,9-11H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | NTIWNFLUZQSLDR-UHFFFAOYSA-N |
| SMILES | CCCCCC(C)OC(=O)C1=CC=CC=C1C(=O)O |
