For research use only. Not for therapeutic Use.
Mono-2-(Methacryloyloxy)ethyl Succinate(Cat No.:M017342)is a specialized methacrylate monomer used in polymer and resin synthesis. This compound features a succinate ester group, enhancing its adhesion properties and flexibility. It is widely utilized in the production of adhesives, coatings, and sealants, offering improved durability and resistance to environmental factors. Its functional group allows for copolymerization with other monomers, creating tailored polymers with desired characteristics. In medical and dental applications, it provides strong bonding and biocompatibility. This versatile monomer is essential in developing advanced materials with specific performance attributes.
CAS Number | 20882-04-6 |
Synonyms | MONO-2-(METHACRYLOYLOXY)ETHYL SUCCINATE;Butanedioicacid,mono[2-[(2-methyl-1-oxo-2-propenyl)oxy]ethyl]ester;[2-[(2-methyl-1-oxoallyl)oxy]ethyl] hydrogen succinate;[2-(Methacryloyloxy)-ethyl]-hydrogen succinate;2-METHACRYLOYLOXYETHYL SUCCINIC ACID;3-[[ |
Molecular Formula | C10H14O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobutanoic acid |
InChI | InChI=1S/C10H14O6/c1-7(2)10(14)16-6-5-15-9(13)4-3-8(11)12/h1,3-6H2,2H3,(H,11,12) |
InChIKey | ZEWLHMQYEZXSBH-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)OCCOC(=O)CCC(=O)O |