Mono-ethyl Malonate-1,2,3-13C3(Cat No.:R002390) is an isotopically labeled chemical used extensively in synthesis and metabolic studies. This compound, enriched with three carbon-13 atoms, provides crucial insights into the incorporation of malonate derivatives in various biochemical pathways. It serves as a key intermediate in the synthesis of more complex molecules and is pivotal in tracing metabolic processes involving malonate in both biological and industrial applications. Its stable isotope labeling ensures accurate detection and quantification in mass spectrometry, facilitating detailed analysis and research in organic chemistry and materials science.
Catalog Number | R002390 |
CAS Number | 1189981-54-1 |
Synonyms | Propanedioic Acid Monoethyl Ester-13C3; (Ethoxycarbonyl)acetic Acid-13C3; 3-Ethoxy-3-oxopropanoic Acid-13C3; |
Molecular Formula | C5H8O4 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 3-ethoxy-3-oxo(1,2,3-13C3)propanoic acid |
InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7)/i3+1,4+1,5+1 |
InChIKey | HGINADPHJQTSKN-FRSWOAELSA-N |
SMILES | CCO[13C](=O)[13CH2][13C](=O)O |