For research use only. Not for therapeutic Use.
Monoacryloyloxyethyl succinate（Cat No.:I032585）, is an acrylate ester derived from succinic acid. It is commonly used as a monomer in the production of polymers and copolymers. Through radical polymerization, it forms polymers with diverse properties, including flexibility, durability, and adhesion. Monoacryloyloxyethyl succinate finds application in the synthesis of adhesives, coatings, and resins, where its acrylate functionality enables cross-linking reactions for enhanced strength and stability.
| Catalog Number | I032585 |
| CAS Number | 50940-49-3 |
| Synonyms | Monoacryloyloxyethyl succinate |
| Molecular Formula | C9H12O6 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Room Temperature |
| IUPAC Name | Butanedioic acid, 1-(2-((1-oxo-2-propen-1-yl)oxy)ethyl) ester |
| InChI | InChI=1S/C9H12O6/c1-2-8(12)14-5-6-15-9(13)4-3-7(10)11/h2H,1,3-6H2,(H,10,11) |
| InChIKey | UZDMJPAQQFSMMV-UHFFFAOYSA-N |
| SMILES | O=C(OCCOC(C=C)=O)CCC(O)=O |
