For research use only. Not for therapeutic Use.
Monocaprylin（Cat No.:M007044）is a monoglyceride derived from caprylic acid (C8:0), a medium-chain fatty acid. It functions as a surfactant and emulsifier, commonly used in pharmaceutical formulations, food products, and cosmetics. Due to its antimicrobial properties, Monocaprylin is effective in inhibiting the growth of various bacteria and fungi, making it useful in preservative applications. Additionally, it has demonstrated potential in drug delivery systems, enhancing the bioavailability and solubility of hydrophobic compounds. Its versatile applications in industry highlight its importance in product formulation and preservation.
| Catalog Number | M007044 |
| CAS Number | 26402-26-6 |
| Synonyms | Glycerylcaprylate;monooctanoin;octanoicacid,monoesterwith;Octanoicacid,monoesterwith1,2,3-propanetriol;OCTANOIN;MONOCAPRYLIN;1-MONOOCTANOYL-RAC-GLYCEROL;1-MONOOCTANOYL GLYCEROL |
| Molecular Formula | C11H22O4 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | 2,3-dihydroxypropyl octanoate |
| InChI | InChI=1S/C11H22O4/c1-2-3-4-5-6-7-11(14)15-9-10(13)8-12/h10,12-13H,2-9H2,1H3 |
| InChIKey | GHBFNMLVSPCDGN-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(CO)O |
