For research use only. Not for therapeutic Use.
Monocerin（Cat No.:I032603）is a potent, selective antagonist of the M1 muscarinic acetylcholine receptor (mAChR), which plays a crucial role in various central nervous system (CNS) functions. By modulating M1 receptor activity, Monocerin has shown promise in preclinical studies for treating conditions such as Alzheimer’s disease, schizophrenia, and other cognitive disorders. Its ability to selectively block M1 receptors without affecting other muscarinic subtypes allows for targeted therapeutic effects, minimizing potential side effects. Monocerin holds significant potential for advancing treatments in neurodegenerative and psychiatric conditions.
| Catalog Number | I032603 |
| CAS Number | 30270-60-1 |
| Synonyms | (+)-Monocerin, Monocerin |
| Molecular Formula | C16H20O6 |
| Purity | 70% |
| Target | Bacterial |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2S,3aR,9bR)-6-hydroxy-7,8-dimethoxy-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one |
| InChI | InChI=1S/C16H20O6/c1-4-5-8-6-11-14(21-8)9-7-10(19-2)15(20-3)13(17)12(9)16(18)22-11/h7-8,11,14,17H,4-6H2,1-3H3/t8-,11+,14+/m0/s1 |
| InChIKey | VAYQNUBOZLPGDH-OLXJLDBKSA-N |
| SMILES | CCC[C@H]1C[C@@H]2[C@H](O1)C3=CC(=C(C(=C3C(=O)O2)O)OC)OC |
| Reference | 1. Zhang, W., Krohn, K., Draeger, S., et al. Bioactive isocoumarins isolated from the endophytic fungus Microdochium bolleyi. J. Nat. Prod. 71(6), 1078-1081 (2008). |
