For research use only. Not for therapeutic Use.
Monoethanolamine palmitate is a bioactive chemical.
| Catalog Number | I032630 |
| CAS Number | 2210-62-0 |
| Synonyms | Monoethanolamine palmitate |
| Molecular Formula | C18H39NO3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2-Hydroxyethyl)ammonium palmitate |
| InChI | InChI=1S/C16H32O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;3-1-2-4/h2-15H2,1H3,(H,17,18);4H,1-3H2 |
| InChIKey | AXAURZWPEBQDNG-UHFFFAOYSA-N |
| SMILES | [NH3+]CCO.CCCCCCCCCCCCCCCC([O-])=O |
