For research use only. Not for therapeutic Use.
Monoisodecyl phthalate is an organic compound commonly used as a plasticizer to enhance the flexibility and durability of plastics, particularly polyvinyl chloride (PVC). Its structure includes a phthalate ester with an isodecyl group, making it effective in improving the performance of various plastic products. Applications include use in automotive parts, flooring, and medical devices, highlighting its importance in manufacturing and industry.
| Catalog Number | R031983 |
| CAS Number | 31047-64-0 |
| Synonyms | 1,2-Benzenedicarboxylic Acid Monoisodecyl Ester; Phthalic Acid Isodecyl Ester |
| Molecular Formula | C18H26O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(8-methylnonoxycarbonyl)benzoic acid |
| InChI | InChI=1S/C18H26O4/c1-14(2)10-6-4-3-5-9-13-22-18(21)16-12-8-7-11-15(16)17(19)20/h7-8,11-12,14H,3-6,9-10,13H2,1-2H3,(H,19,20) |
| InChIKey | ZICLWBMRDQUIDO-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCCOC(=O)C1=CC=CC=C1C(=O)O |
