For research use only. Not for therapeutic Use.
Monomenthyl succinate (-)-（Cat No.:I032656）4, is an ester derived from menthol and succinic acid. It is the levorotatory enantiomer, rotating plane-polarized light to the left. The compound’s specific applications and uses are not readily available, but it may find potential in fragrance or flavor industries.
| Catalog Number | I032656 |
| CAS Number | 77341-67-4 |
| Synonyms | Monomenthyl succinate, (-)- |
| Molecular Formula | C14H24O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Room Temperature |
| IUPAC Name | 4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid |
| InChI | InChI=1S/C14H24O4/c1-9(2)11-5-4-10(3)8-12(11)18-14(17)7-6-13(15)16/h9-12H,4-8H2,1-3H3,(H,15,16)/t10-,11+,12-/m1/s1 |
| InChIKey | BLILOGGUTRWFNI-GRYCIOLGSA-N |
| SMILES | CC1CCC(C(C1)OC(=O)CCC(=O)O)C(C)C |
