For research use only. Not for therapeutic Use.
Apatinib-d8 free base（Cat No.:S000452） is a deuterated form of lapatinib, where eight hydrogen atoms are replaced with deuterium, enhancing its use in detailed pharmacokinetic and metabolic stability studies. Apatinib is a tyrosine kinase inhibitor specifically targeting the vascular endothelial growth factor receptor 2 (VEGFR2), used primarily in the treatment of gastric cancer and other advanced malignancies. By inhibiting this receptor, apatinib impedes angiogenesis, which is crucial for tumor growth and metastasis.
| Catalog Number | S000452 |
| CAS Number | 1398065-74-1 |
| Molecular Formula | C16H18D4O4 |
| Purity | ≥95% |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-octoxycarbonylbenzoate |
| InChI | InChI=1S/C16H22O4/c1-2-3-4-5-6-9-12-20-16(19)14-11-8-7-10-13(14)15(17)18/h7-8,10-11H,2-6,9,12H2,1H3,(H,17,18)/p-1/i7D,8D,10D,11D |
| InChIKey | PKIYFBICNICNGJ-LLDRQJGISA-M |
| SMILES | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)[O-] |
