For research use only. Not for therapeutic Use.
Monoolein-d5（Cat No.:S000768） is a deuterium-labeled variant of monoolein, a glycerol monoester of oleic acid widely used in food and pharmaceutical formulations. With the chemical formula C21H35D5O4, this molecule features five deuterium atoms replacing hydrogen atoms at specific positions. The isotopic labeling significantly improves the molecule’s detectability and stability in analytical methods such as mass spectrometry and NMR spectroscopy. Monoolein-d5 is primarily used in research to study lipid bilayers and emulsion systems, offering insights into the behavior and interaction of lipids in biological membranes and during digestion processes.
| Catalog Number | S000768 |
| CAS Number | 565183-24-6 |
| Molecular Formula | C21H35D5O4 |
| Purity | ≥95% |
| IUPAC Name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (Z)-octadec-9-enoate |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/i18D2,19D2,20D |
| InChIKey | RZRNAYUHWVFMIP-FNKKQMTJSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O |
