For research use only. Not for therapeutic Use.
Monopentyl Phthalate (Cat.No:R054484) is a chemical compound used as a plasticizer in the manufacturing of various plastic and polymer products. It imparts flexibility and durability to plastics, making it suitable for applications like PVC pipes, cable insulation, and vinyl flooring.
CAS Number | 24539-56-8 |
Synonyms | 1,2-Benzenedicarboxylic Acid 1-Pentyl Ester; 1,2-Benzenedicarboxylic Acid Monopentyl Ester; Phthalic Acid Monopentyl Ester; Phthalic Acid Pentyl Ester; Mono-n-pentyl Phthalate; Monoamyl Phthalate; MPP; |
Molecular Formula | C13H16O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-pentoxycarbonylbenzoic acid |
InChI | InChI=1S/C13H16O4/c1-2-3-6-9-17-13(16)11-8-5-4-7-10(11)12(14)15/h4-5,7-8H,2-3,6,9H2,1H3,(H,14,15) |
InChIKey | FPGPRAKRYDSZAW-UHFFFAOYSA-N |
SMILES | CCCCCOC(=O)C1=CC=CC=C1C(=O)O |