For research use only. Not for therapeutic Use.
Monopentyl Phthalate (Cat.No:R054484) is a chemical compound used as a plasticizer in the manufacturing of various plastic and polymer products. It imparts flexibility and durability to plastics, making it suitable for applications like PVC pipes, cable insulation, and vinyl flooring.
| Catalog Number | R054484 |
| CAS Number | 24539-56-8 |
| Synonyms | 1,2-Benzenedicarboxylic Acid 1-Pentyl Ester; 1,2-Benzenedicarboxylic Acid Monopentyl Ester; Phthalic Acid Monopentyl Ester; Phthalic Acid Pentyl Ester; Mono-n-pentyl Phthalate; Monoamyl Phthalate; MPP; |
| Molecular Formula | C13H16O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-pentoxycarbonylbenzoic acid |
| InChI | InChI=1S/C13H16O4/c1-2-3-6-9-17-13(16)11-8-5-4-7-10(11)12(14)15/h4-5,7-8H,2-3,6,9H2,1H3,(H,14,15) |
| InChIKey | FPGPRAKRYDSZAW-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)C1=CC=CC=C1C(=O)O |
