For research use only. Not for therapeutic Use.
Mor-DalPhos is a ligand used in transition metal catalysis, particularly in palladium-catalyzed cross-coupling reactions. Known for its high efficiency and selectivity, it facilitates the formation of carbon-carbon and carbon-heteroatom bonds. This makes Mor-DalPhos a valuable tool in organic synthesis, enabling the production of complex molecules in pharmaceuticals and materials science.
| Catalog Number | R035897 |
| CAS Number | 1237588-12-3 |
| Synonyms | 4-[2-[Bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino]phenyl]morpholine; Bis(adamant-1-yl)(2-morpholinophenyl)phosphine; |
| Molecular Formula | C30H42NOP |
| Purity | ≥95% |
| Storage | +4℃ |
| IUPAC Name | bis(1-adamantyl)-(2-morpholin-4-ylphenyl)phosphane |
| InChI | InChI=1S/C30H42NOP/c1-2-4-28(27(3-1)31-5-7-32-8-6-31)33(29-15-21-9-22(16-29)11-23(10-21)17-29)30-18-24-12-25(19-30)14-26(13-24)20-30/h1-4,21-26H,5-20H2 |
| InChIKey | CCBRRSUORFMQCZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CC=C2P(C34CC5CC(C3)CC(C5)C4)C67CC8CC(C6)CC(C8)C7 |
