For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Moracin C (CAS 69120-06-5), one of the <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">new phytoalexins from diseased mulberry, is antifungal compound.</span></span></span></span>
| Catalog Number | R063569 |
| CAS Number | 69120-06-5 |
| Molecular Formula | C19H18O4 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 5-(6-hydroxy-1-benzofuran-2-yl)-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| InChI | InChI=1S/C19H18O4/c1-11(2)3-6-15-16(21)7-13(8-17(15)22)18-9-12-4-5-14(20)10-19(12)23-18/h3-5,7-10,20-22H,6H2,1-2H3 |
| InChIKey | ZTGHWUWBQNCCOH-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C=C1O)C2=CC3=C(O2)C=C(C=C3)O)O)C |
| Reference | <span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Takasugi, Mitsuo, et al. "Moracin C and D, new phytoalexins from diseased mulberry." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Chemistry Letters</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 7.11 (1978): 1239-1240.<br /> |
