For research use only. Not for therapeutic Use.
Moracin N(CAT: I040864) is a naturally occurring flavonoid compound found in several plants, particularly in the genus Morus (mulberry). It exhibits anti-inflammatory, antioxidant, and anticancer properties, making it of significant interest in Cancer Disease Research. Moracin N acts by modulating various signaling pathways involved in cell growth, apoptosis, and inflammation. It has been shown to inhibit the activity of key enzymes involved in cancer cell proliferation, such as cyclooxygenase-2 (COX-2), and promotes the activation of tumor-suppressor pathways. Due to its ability to regulate oxidative stress and inflammation, Moracin N is being explored as a potential adjunctive treatment for cancer and other chronic inflammatory conditions.
CAS Number | 135248-05-4 |
Synonyms | 5-[6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-2-yl]benzene-1,3-diol |
Molecular Formula | C19H18O4 |
Purity | ≥95% |
IUPAC Name | 5-[6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-2-yl]benzene-1,3-diol |
InChI | InChI=1S/C19H18O4/c1-11(2)3-4-12-5-13-8-18(23-19(13)10-17(12)22)14-6-15(20)9-16(21)7-14/h3,5-10,20-22H,4H2,1-2H3 |
InChIKey | WBSCSIABHGPAMC-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C=C2C(=C1)C=C(O2)C3=CC(=CC(=C3)O)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |