For research use only. Not for therapeutic Use.
Moracin N is a ferroptosis inhibitor that can be isolated from mulberry leaf. Moracin N exerts neuroprotective activity through preventing from oxidative stress[1].
| Catalog Number | I040864 |
| CAS Number | 135248-05-4 |
| Synonyms | 5-[6-hydroxy-5-(3-methylbut-2-enyl)-1-benzofuran-2-yl]benzene-1,3-diol |
| Molecular Formula | C19H18O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H18O4/c1-11(2)3-4-12-5-13-8-18(23-19(13)10-17(12)22)14-6-15(20)9-16(21)7-14/h3,5-10,20-22H,4H2,1-2H3 |
| InChIKey | WBSCSIABHGPAMC-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C2C(=C1)C=C(O2)C3=CC(=CC(=C3)O)O)O)C |
| Reference | [1]. Wen L, et.al. Identification of prenylated phenolics in mulberry leaf and their neuroprotective activity. Phytomedicine. 2021 Sep;90:153641. |
