For research use only. Not for therapeutic Use.
Mordant Blue 13(Cat No.:M069326), is a synthetic organic dye known for its application in the textile and dyeing industry. It is classified as a mordant dye, which means it forms a stable complex with metal ions, typically aluminum or chromium, to create a colorfast bond with fabrics like cotton and wool. Mordant dyes like Mordant Blue 13 have been historically used to achieve a wide range of vibrant and durable colors in textiles.
CAS Number | 1058-92-0 |
Molecular Formula | C16H9ClN2Na2O9S2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | disodium;3-[(5-chloro-2-hydroxyphenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonate |
InChI | InChI=1S/C16H11ClN2O9S2.2Na/c17-8-1-2-11(20)10(5-8)18-19-15-13(30(26,27)28)4-7-3-9(29(23,24)25)6-12(21)14(7)16(15)22;;/h1-6,20-22H,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
InChIKey | LNXMADNIUWFTPP-UHFFFAOYSA-L |
SMILES | C1=CC(=C(C=C1Cl)N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])O)O)O.[Na+].[Na+] |