For research use only. Not for therapeutic Use.
Moricizine hydrochloride（Cat No.:R045871）is a medication primarily used as an antiarrhythmic agent to treat irregular heart rhythms, particularly ventricular arrhythmias. It works by stabilizing the electrical activity of the heart, preventing abnormal electrical impulses that can lead to arrhythmias. Moricizine hydrochloride acts by blocking sodium and potassium channels, which slows down the conduction of electrical signals in the heart, helping to restore normal rhythm. It is typically used when other antiarrhythmic drugs are ineffective. The drug is taken orally and requires careful monitoring due to potential side effects and interactions with other medications.
| CAS Number | 29560-58-5 |
| Synonyms | ethyl N-[10-(3-morpholin-4-ylpropanoyl)phenothiazin-2-yl]carbamate;hydrochloride |
| Molecular Formula | C22H26ClN3O4S |
| Purity | ≥95% |
| IUPAC Name | ethyl N-[10-(3-morpholin-4-ylpropanoyl)phenothiazin-2-yl]carbamate;hydrochloride |
| InChI | InChI=1S/C22H25N3O4S.ClH/c1-2-29-22(27)23-16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)30-20)21(26)9-10-24-11-13-28-14-12-24;/h3-8,15H,2,9-14H2,1H3,(H,23,27);1H |
| InChIKey | GAQAKFHSULJNAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=CC2=C(C=C1)SC3=CC=CC=C3N2C(=O)CCN4CCOCC4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
