For research use only. Not for therapeutic Use.
Morphiceptin is a potent and specific agonist for morphine (μ) receptors. Morphiceptin, as a synthetic peptide, is the amide of a fragment of the milk protein β-casein. Morphiceptin has morphinelike activities and is highly specific for morphine (μ) receptors but not for enkephalin (⸹) receptors[1].
Morphiceptin potently inhibits the binding of [3H]dihydromorphine, 125I-labeled FK33824, and [3H]naloxone to rat brain membrane preparations with a 50 percent inhibition concentration (IC50) of about 20 nM[1].
| Catalog Number | I044312 |
| CAS Number | 74135-04-9 |
| Synonyms | (2S)-1-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-N-[(2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-1-oxo-3-phenylpropan-2-yl]pyrrolidine-2-carboxamide |
| Molecular Formula | C28H35N5O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C28H35N5O5/c29-21(16-19-10-12-20(34)13-11-19)27(37)33-15-5-9-24(33)26(36)31-22(17-18-6-2-1-3-7-18)28(38)32-14-4-8-23(32)25(30)35/h1-3,6-7,10-13,21-24,34H,4-5,8-9,14-17,29H2,(H2,30,35)(H,31,36)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | LSQXZIUREIDSHZ-ZJZGAYNASA-N |
| SMILES | C1CC(N(C1)C(=O)C(CC2=CC=C(C=C2)O)N)C(=O)NC(CC3=CC=CC=C3)C(=O)N4CCCC4C(=O)N |
| Reference | [1]. Chang KJ, et al. Morphiceptin (NH4-tyr-pro-phe-pro-COHN2): a potent and specific agonist for morphine (mu) receptors. Science. 1981;212(4490):75-77. |
