For research use only. Not for therapeutic Use.
Morphothiadin is an investigational antiviral compound known for its potential activity against hepatitis viruses, particularly hepatitis B (HBV). It targets the viral replication process, specifically interfering with the assembly and maturation of viral particles, thereby preventing the production of infectious virions. Morphothiadin is being studied for its ability to suppress HBV replication and could offer a novel treatment approach for chronic hepatitis B infection. Its unique mechanism of action, targeting viral assembly, makes it a promising candidate in the development of new therapies for managing hepatitis B and other viral infections.
| Catalog Number | I008135 |
| CAS Number | 1092970-12-1 |
| Synonyms | ethyl 4-(2-bromo-4-fluorophenyl)-6-(morpholin-4-ylmethyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| Molecular Formula | C21H22BrFN4O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C21H22BrFN4O3S/c1-2-30-21(28)17-16(12-27-6-8-29-9-7-27)25-19(20-24-5-10-31-20)26-18(17)14-4-3-13(23)11-15(14)22/h3-5,10-11,18H,2,6-9,12H2,1H3,(H,25,26) |
| InChIKey | SQGRDKSRFFUBBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=NC1C2=C(C=C(C=C2)F)Br)C3=NC=CS3)CN4CCOCC4 |
