For research use only. Not for therapeutic Use.
Mosapride(CAT: I000490) is a selective 5-HT4 receptor agonist widely used in gastrointestinal research. It enhances gastrointestinal motility by stimulating serotonin receptors in the enteric nervous system, promoting peristalsis and gastric emptying. Mosapride is particularly valuable in studying disorders such as gastroesophageal reflux disease (GERD) and functional dyspepsia. Its role in modulating neurotransmitter activity provides insights into the mechanisms of motility disorders and potential therapeutic strategies. With high purity and reliability, Mosapride is an essential compound for advancing research in gastrointestinal pharmacology and treatment development.
| Catalog Number | I000490 |
| CAS Number | 112885-41-3 |
| Synonyms | 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide |
| Molecular Formula | C21H25ClFN3O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10mM in Ethanol |
| Storage | Store at -20C |
| IUPAC Name | 4-amino-5-chloro-2-ethoxy-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]benzamide |
| InChI | InChI=1S/C21H25ClFN3O3/c1-2-28-20-10-19(24)18(22)9-17(20)21(27)25-11-16-13-26(7-8-29-16)12-14-3-5-15(23)6-4-14/h3-6,9-10,16H,2,7-8,11-13,24H2,1H3,(H,25,27) |
| InChIKey | YPELFRMCRYSPKZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)NCC2CN(CCO2)CC3=CC=C(C=C3)F)Cl)N |
