For research use only. Not for therapeutic Use.
Mosloflavone(CA: R072383) is a natural flavonoid compound found in certain plant sources, particularly in the bark of the tree Erythrina variegata (also known as Indian Coral Tree). Its mode of action involves being a flavonoid with potential pharmacological properties. Mosloflavone has been studied for its potential antioxidant, anti-inflammatory, and antiviral effects. It has shown promise in inhibiting certain enzymes involved in inflammation and oxidative stress. Due to its interesting bioactivity, Mosloflavone is of interest in medicinal research and herbal remedies.
| Catalog Number | R072383 |
| CAS Number | 740-33-0 |
| Molecular Formula | C17H14O5 |
| Purity | ≥95% |
| Target | Enterovirus |
| IUPAC Name | 5-hydroxy-6,7-dimethoxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C17H14O5/c1-20-14-9-13-15(16(19)17(14)21-2)11(18)8-12(22-13)10-6-4-3-5-7-10/h3-9,19H,1-2H3 |
| InChIKey | SIVAITYPYQQYAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O)OC |
