For research use only. Not for therapeutic Use.
Mosloflavone(Cat No.:R072383)is a naturally occurring flavonoid found in various plant species, known for its diverse pharmacological properties. It exhibits antioxidant, anti-inflammatory, antimicrobial, and anticancer activities, making it a valuable compound in drug discovery and natural product research. Mosloflavone’s ability to scavenge free radicals and modulate cellular signaling pathways highlights its therapeutic potential in managing oxidative stress-related disorders. Additionally, its cytotoxic effects on cancer cells have garnered interest in oncology research. Mosloflavone is widely studied for its role in exploring plant-derived bioactives and developing novel therapeutic agents.
CAS Number | 740-33-0 |
Molecular Formula | C17H14O5 |
Purity | ≥95% |
Target | Enterovirus |
IUPAC Name | 5-hydroxy-6,7-dimethoxy-2-phenylchromen-4-one |
InChI | InChI=1S/C17H14O5/c1-20-14-9-13-15(16(19)17(14)21-2)11(18)8-12(22-13)10-6-4-3-5-7-10/h3-9,19H,1-2H3 |
InChIKey | SIVAITYPYQQYAP-UHFFFAOYSA-N |
SMILES | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O)OC |