For research use only. Not for therapeutic Use.
Mosnodenvir(CAT: I040915) is an antiviral compound primarily used in the treatment of infections caused by viruses, particularly those affecting the respiratory tract. It works by inhibiting viral replication through targeting specific viral enzymes or proteins essential for the viral life cycle. While its exact mechanism of action may vary, it typically interferes with the ability of the virus to reproduce, thereby reducing the severity and duration of the infection. Mosnodenvir is especially relevant for Infection Disease Research, where it may be explored as a potential therapeutic for viral infections, including those caused by influenza, coronaviruses, or other respiratory viruses.
| CAS Number | 2043343-94-6 |
| Synonyms | 2-(4-chloro-2-methoxyphenyl)-2-(3-methoxy-5-methylsulfonylanilino)-1-[5-(trifluoromethoxy)-1H-indol-3-yl]ethanone |
| Molecular Formula | C26H22ClF3N2O6S |
| Purity | ≥95% |
| IUPAC Name | 2-(4-chloro-2-methoxyphenyl)-2-(3-methoxy-5-methylsulfonylanilino)-1-[5-(trifluoromethoxy)-1H-indol-3-yl]ethanone |
| InChI | InChI=1S/C26H22ClF3N2O6S/c1-36-17-9-15(10-18(11-17)39(3,34)35)32-24(19-6-4-14(27)8-23(19)37-2)25(33)21-13-31-22-7-5-16(12-20(21)22)38-26(28,29)30/h4-13,24,31-32H,1-3H3 |
| InChIKey | QNOPDDHSGQQLCV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)NC(C2=C(C=C(C=C2)Cl)OC)C(=O)C3=CNC4=C3C=C(C=C4)OC(F)(F)F)S(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
