For research use only. Not for therapeutic Use.
Moxifloxacin HCl(Cat No.:A000882)is a broad-spectrum antibiotic belonging to the fluoroquinolone class, used to treat various bacterial infections, including respiratory, skin, and intra-abdominal infections. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes crucial for DNA replication and repair, leading to bacterial cell death. Moxifloxacin HCl is known for its high oral bioavailability and extensive tissue penetration, ensuring effective treatment. Its once-daily dosing enhances patient compliance. While generally well-tolerated, it may cause side effects like gastrointestinal disturbances and, rarely, tendonitis or QT interval prolongation.
CAS Number | 186826-86-8 |
Synonyms | BAY12-8039 HCl |
Molecular Formula | C21H24FN3O4 • HCl |
Purity | ≥95% |
Target | Bacterial |
Solubility | >19.2mg/mL in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid;hydrochloride |
InChI | InChI=1S/C21H24FN3O4.ClH/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24;/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28);1H/t11-,16+;/m0./s1 |
InChIKey | IDIIJJHBXUESQI-DFIJPDEKSA-N |
SMILES | COC1=C2C(=CC(=C1N3CC4CCCNC4C3)F)C(=O)C(=CN2C5CC5)C(=O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |