Moxifloxacin Hydrochloride-13CD3 is an isotopically labeled version of the antibiotic Moxifloxacin, where the compound is enriched with carbon-13 and deuterium atoms. This specific labeling allows researchers to track and analyze the pharmacokinetics, metabolism, and distribution of Moxifloxacin with high precision using mass spectrometry and NMR spectroscopy. The 13C and deuterium labeling provide distinct mass differences, facilitating detailed studies on the drug’s interaction with biological systems and its metabolic pathways. Moxifloxacin Hydrochloride-13CD3 is essential for developing more effective antimicrobial therapies and enhancing our understanding of antibiotic resistance mechanisms, contributing to advancements in pharmaceutical research and development.
| Catalog Number | R047389 |
| CAS Number | 1246816-75-0 |
| Synonyms | 1-Cyclopropyl-6-fluoro-1,4-dihydro-8-methoxy-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo-3-quinolinecarboxylic Acid-13CD3 Hydrochloride; BAY-12-8039-13CD3; Actira-13CD3; Avalox-13CD3; Proflox-13CD3; |
| Molecular Formula | C21H25ClFN3O4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-4-oxo-8-(trideuteriomethoxy)quinoline-3-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C21H24FN3O4.ClH/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24;/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28);1H/t11-,16+;/m0./s1/i1+1D3; |
| InChIKey | IDIIJJHBXUESQI-XPTSQQLBSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C2C(=CC(=C1N3C[C@@H]4CCCN[C@@H]4C3)F)C(=O)C(=CN2C5CC5)C(=O)O.Cl |
