For research use only. Not for therapeutic Use.
MPP+-d3 iodide(Cat No.:S000369) is a chemical derivative of MPP+ iodide, specifically altered to include deuterium atoms at the third position of its molecular structure. This modification is intended to investigate the molecule’s biochemical behavior and stability. MPP+ is a well-known neurotoxin related to the compound MPTP, which selectively damages dopamine neurons, making it useful in research related to Parkinson’s disease. By incorporating deuterium, researchers aim to understand how subtle changes affect its interaction with biological systems, potentially leading to insights into the mechanism of neuronal degeneration.
Catalog Number | S000369 |
CAS Number | 207556-07-8 |
Molecular Formula | C12H9D3IN |
Purity | ≥95% |
Target | Mitochondrial Metabolism |
IUPAC Name | 4-phenyl-1-(trideuteriomethyl)pyridin-1-ium;iodide |
InChI | InChI=1S/C12H12N.HI/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10H,1H3;1H/q+1;/p-1/i1D3; |
InChIKey | RFDFRDXIIKROAI-NIIDSAIPSA-M |
SMILES | C[N+]1=CC=C(C=C1)C2=CC=CC=C2.[I-] |