For research use only. Not for therapeutic Use.
MRK-898(Cat No.:I041085)is a potent, selective inhibitor of the protein kinase cAMP-dependent protein kinase (PKA), which plays a crucial role in various cellular signaling pathways. By inhibiting PKA activity, MRK-898 can modulate processes such as cell growth, metabolism, and gene expression. Preclinical studies suggest that MRK-898 may have therapeutic potential in treating cancers, including those driven by dysregulated PKA activity. Its ability to specifically target PKA makes it a promising candidate for further research in oncology and other diseases where PKA is implicated in disease progression.
CAS Number | 461450-30-6 |
Synonyms | 5-fluoro-2-[2-fluoro-5-[7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-3-yl]phenyl]benzonitrile |
Molecular Formula | C20H9F5N4 |
Purity | ≥95% |
IUPAC Name | 5-fluoro-2-[2-fluoro-5-[7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-3-yl]phenyl]benzonitrile |
InChI | InChI=1S/C20H9F5N4/c21-13-2-3-14(12(7-13)9-26)15-8-11(1-4-16(15)22)17-10-27-19-28-18(20(23,24)25)5-6-29(17)19/h1-8,10H |
InChIKey | XXRKXVKJMSIZSM-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C2=CN=C3N2C=CC(=N3)C(F)(F)F)C4=C(C=C(C=C4)F)C#N)F |