For research use only. Not for therapeutic Use.
N-Propargylnitrendipine(CAT: I010474) is a chemical derivative of nitrendipine, a calcium channel blocker. This compound is primarily studied for its role in modulating L-type calcium channels, influencing calcium influx in smooth muscle and cardiac cells. N-Propargylnitrendipine is significant in cardiovascular research, where it is used to explore mechanisms underlying vasodilation, hypertension management, and cardiac function. Its unique propargyl group may also contribute to enhanced pharmacological properties or selectivity, providing insights into the development of advanced calcium channel-targeted therapeutics.
| Catalog Number | I010474 |
| CAS Number | 544478-19-5 |
| Synonyms | Alternative Name: N-Propylargylnitrendipine |
| Molecular Formula | C21H22N2O6 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 10 mM in ethanol with gentle warming and to 10 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1-prop-2-ynyl-4H-pyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C21H22N2O6/c1-6-11-22-13(3)17(20(24)28-5)19(18(14(22)4)21(25)29-7-2)15-9-8-10-16(12-15)23(26)27/h1,8-10,12,19H,7,11H2,2-5H3 |
| InChIKey | BITHABUTZRAUGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)CC#C)C |
