For research use only. Not for therapeutic Use.
MRS 2578(Cat No.:I004658)is a highly potent inhibitor of the P2Y6 receptor, with an IC50 value of 37 nM. While it exhibits weak activity at the P2Y1, P2Y2, P2Y4, and P2Y11 receptors, its primary selectivity lies in targeting the P2Y6 receptor. P2Y6 receptors are involved in various physiological processes, including inflammation and immune responses. By inhibiting P2Y6 receptor signaling, MRS 2578 provides a valuable tool for studying the specific functions and potential therapeutic interventions associated with P2Y6 receptor activation in various disease conditions.
CAS Number | 711019-86-2 |
Synonyms | 1-(3-isothiocyanatophenyl)-3-[4-[(3-isothiocyanatophenyl)carbamothioylamino]butyl]thiourea |
Molecular Formula | C20H20N6S4 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 80 mg/mL |
Storage | 2-8°C |
IC50 | 37 nM [1] |
IUPAC Name | 1-(3-isothiocyanatophenyl)-3-[4-[(3-isothiocyanatophenyl)carbamothioylamino]butyl]thiourea |
InChI | InChI=1S/C20H20N6S4/c27-13-23-15-5-3-7-17(11-15)25-19(29)21-9-1-2-10-22-20(30)26-18-8-4-6-16(12-18)24-14-28/h3-8,11-12H,1-2,9-10H2,(H2,21,25,29)(H2,22,26,30) |
InChIKey | QOHNRGHTJPFMSL-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)N=C=S)NC(=S)NCCCCNC(=S)NC2=CC(=CC=C2)N=C=S |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |