For research use only. Not for therapeutic Use.
MRS1041（Cat No.:I008148）is a selective and potent antagonist of the A3 adenosine receptor, which is involved in regulating various physiological processes like inflammation, vasodilation, and immune function. By blocking the A3 receptor, MRS1041 has the potential to modulate inflammatory responses and might be explored for therapeutic applications in conditions such as autoimmune diseases, cardiovascular disorders, and cancer. It is a compound under preclinical investigation, with researchers studying its ability to alleviate inflammation and promote tissue protection. However, its safety profile and clinical efficacy are still being evaluated in ongoing studies.
| Catalog Number | I008148 |
| CAS Number | 176220-89-6 |
| Synonyms | MRS1041; MRS 1041; MRS-1041.;3,5,7-triethoxy-2-phenylchromen-4-one |
| Molecular Formula | C21H22O5 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 3,5,7-triethoxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C21H22O5/c1-4-23-15-12-16(24-5-2)18-17(13-15)26-20(14-10-8-7-9-11-14)21(19(18)22)25-6-3/h7-13H,4-6H2,1-3H3 |
| InChIKey | YMQQPRDUZIXHBJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C(=C1)OCC)C(=O)C(=C(O2)C3=CC=CC=C3)OCC |
