For research use only. Not for therapeutic Use.
MRS1191 (CAT: I008162) is a selective A3 adenosine receptor antagonist. Adenosine receptors are a class of G protein-coupled receptors that are involved in various physiological processes. MRS1191 specifically targets and blocks the A3 adenosine receptor subtype, preventing the binding of adenosine and inhibiting its downstream signaling pathways. By selectively antagonizing the A3 adenosine receptor, MRS1191 can modulate the activity of adenosine, potentially leading to therapeutic effects in conditions where A3 receptor activation is involved. Its selectivity for the A3 receptor makes it a valuable tool for studying the role of this receptor subtype and exploring its potential as a target for drug development.
CAS Number | 185222-90-6 |
Synonyms | MRS1191; MRS 1191; MRS-1191.;O3-ethyl O5-(phenylmethyl) 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
Molecular Formula | C31H27NO4 |
Purity | ≥95% |
Target | Adenosine Receptor |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 5-O-benzyl 3-O-ethyl 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
InChI | InChI=1S/C31H27NO4/c1-3-35-30(33)27-22(2)32-29(25-17-11-6-12-18-25)28(26(27)20-19-23-13-7-4-8-14-23)31(34)36-21-24-15-9-5-10-16-24/h4-18,26,32H,3,21H2,1-2H3 |
InChIKey | SNVFDPHQAOXWJZ-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(NC(=C(C1C#CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3)C4=CC=CC=C4)C |
Reference | 1: Inoue Y, Tanaka H, Sumi Y, Woehrle T, Chen Y, Hirsh MI, Junger WG. A3 2: Das S, Tosaki A, Bagchi D, Maulik N, Das DK. Resveratrol-mediated activation </br> |