For research use only. Not for therapeutic Use.
MRS928 is a selective and potent inhibitor of the equilibrative nucleoside transporter 1 (ENT1), a protein responsible for regulating the uptake and release of nucleosides such as adenosine across cell membranes. By inhibiting ENT1, MRS928 increases extracellular adenosine levels, which can have various therapeutic effects, including anti-inflammatory and cardioprotective properties. This compound is primarily used in research to explore the role of ENT1 in diseases like cancer, cardiovascular conditions, and inflammatory disorders. MRS928’s specificity for ENT1 makes it a valuable tool for studying adenosine signaling and developing therapies targeting nucleoside transport processes.
| Catalog Number | I008196 |
| CAS Number | 26964-29-4 |
| Synonyms | MRS928; MRS 928; MRS-928.;3,5,7-trimethoxy-2-phenylchromen-4-one |
| Molecular Formula | C18H16O5 |
| Purity | ≥95% |
| Target | Plants |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 3,5,7-trimethoxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | CBTHKWVPSIGKMI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC=CC=C3)OC |
