For research use only. Not for therapeutic Use.
MRT-14 is a potent antagonist of Smo. Smo is the major component involved in signal transduction of the Hedgehog (Hh) morphogens. MRT-14 has the potential for the research of several types of cancers linked to abnormal Hh signaling[1].
| Catalog Number | I043972 |
| CAS Number | 1263131-83-4 |
| Synonyms | N-[N’-(3-benzamidophenyl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
| Molecular Formula | C24H24N4O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H24N4O5/c1-31-19-12-16(13-20(32-2)21(19)33-3)23(30)28-24(25)27-18-11-7-10-17(14-18)26-22(29)15-8-5-4-6-9-15/h4-14H,1-3H3,(H,26,29)(H3,25,27,28,30) |
| InChIKey | CIWMWTKJZQOXBC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NC(=NC2=CC=CC(=C2)NC(=O)C3=CC=CC=C3)N |
| Reference | [1]. Manetti F, et al. Virtual screening-based discovery and mechanistic characterization of the acylthiourea MRT-10 family as smoothened antagonists. Mol Pharmacol. 2010;78(4):658-665. |
