For research use only. Not for therapeutic Use.
MRT-2359（Cat No.:I041288）is an experimental small molecule inhibitor that targets the signaling pathway of the AXL receptor tyrosine kinase, which plays a crucial role in cancer cell survival, migration, and resistance to therapy. By inhibiting AXL, MRT-2359 has shown potential in preclinical studies to reduce tumor growth and enhance the efficacy of other cancer treatments, particularly in cancers that exhibit resistance to conventional therapies. Research is ongoing to evaluate its safety, pharmacokinetics, and potential as a targeted therapy for various malignancies, including non-small cell lung cancer and breast cancer.
| CAS Number | 2803881-11-8 |
| Synonyms | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-(trifluoromethoxy)phenyl]carbamate |
| Molecular Formula | C22H17F4N3O6 |
| Purity | ≥95% |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[2-fluoro-5-(trifluoromethoxy)phenyl]carbamate |
| InChI | InChI=1S/C22H17F4N3O6/c23-15-4-3-13(35-22(24,25)26)8-16(15)27-21(33)34-10-11-1-2-12-9-29(20(32)14(12)7-11)17-5-6-18(30)28-19(17)31/h1-4,7-8,17H,5-6,9-10H2,(H,27,33)(H,28,30,31) |
| InChIKey | HNTGMIGBGVFOBT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3)COC(=O)NC4=C(C=CC(=C4)OC(F)(F)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
