For research use only. Not for therapeutic Use.
MRT68921 (CAT.: I008198) is a selective ATP-competitive inhibitor of the enzyme Akt, which plays a key role in regulating cell growth, survival, and metabolism. Akt is often dysregulated in various cancers and metabolic diseases, making it a target for therapeutic intervention. MRT68921 has been studied for its potential to inhibit Akt signaling, which could slow down tumor progression and promote cell death in cancer cells. Additionally, it may have applications in treating metabolic disorders and cardiovascular diseases related to Akt dysfunction.
Catalog Number | I008198 |
CAS Number | 1190379-70-4 |
Synonyms | MRT68921;Cyclobutanecarboxylic acid {3-[2-cyclopropyl-5-(2-methyl-1,2,3,4-tetrahydro-isoquinolin-6-ylamino)-phenylamino]-propyl}-amide |
Molecular Formula | C25H34N6O |
Purity | ≥95% |
Target | ULK |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | N-[3-[[5-cyclopropyl-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
InChI | InChI=1S/C25H34N6O/c1-31-13-10-19-14-21(9-8-20(19)16-31)29-25-28-15-22(17-6-7-17)23(30-25)26-11-3-12-27-24(32)18-4-2-5-18/h8-9,14-15,17-18H,2-7,10-13,16H2,1H3,(H,27,32)(H2,26,28,29,30) |
InChIKey | KKISLZKMBSCLSS-UHFFFAOYSA-N |
SMILES | CN(C1)CCC2=C1C=CC(NC3=NC=C(C4CC4)C(NCCCNC(C5CCC5)=O)=N3)=C2 |