For research use only. Not for therapeutic Use.
MRTF/SRF-IN-1（Cat No.:I024243）is a small molecule inhibitor designed to target the myocardin-related transcription factors (MRTF) and serum response factor (SRF) pathway, which plays a critical role in cellular processes such as migration, proliferation, and differentiation. This pathway is often dysregulated in cancer and fibrosis. By inhibiting MRTF/SRF signaling, MRTF/SRF-IN-1 aims to reduce tumor growth and fibrosis progression. Preclinical studies have shown promise in its ability to suppress the growth of various cancers and fibrotic diseases, positioning MRTF/SRF-IN-1 as a potential therapeutic option for these conditions.
| CAS Number | 1922098-90-5 |
| Synonyms | N-(4-chlorophenyl)-5,5-difluoro-1-(3-fluoro-5-pyridin-4-ylbenzoyl)piperidine-3-carboxamide |
| Molecular Formula | C24H19ClF3N3O2 |
| Purity | ≥95% |
| IUPAC Name | N-(4-chlorophenyl)-5,5-difluoro-1-(3-fluoro-5-pyridin-4-ylbenzoyl)piperidine-3-carboxamide |
| InChI | InChI=1S/C24H19ClF3N3O2/c25-19-1-3-21(4-2-19)30-22(32)18-12-24(27,28)14-31(13-18)23(33)17-9-16(10-20(26)11-17)15-5-7-29-8-6-15/h1-11,18H,12-14H2,(H,30,32) |
| InChIKey | BEDJWRJGMARXLZ-UHFFFAOYSA-N |
| SMILES | C1C(CN(CC1(F)F)C(=O)C2=CC(=CC(=C2)C3=CC=NC=C3)F)C(=O)NC4=CC=C(C=C4)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
