For research use only. Not for therapeutic Use.
MRTX-1719 hydrochloride is a potent first-in-class selective inhibitor of the PRMT5/MTA complex, with an IC50 of less than 10 nM in PRMT5/MTA MTAPDEL SDMA cells[1].
| Catalog Number | I042066 |
| Synonyms | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-4-chloro-6-cyclopropyloxy-3-fluorobenzonitrile;hydrochloride |
| Molecular Formula | C23H19Cl2FN6O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H18ClFN6O2.ClH/c1-31-22(20-15(8-26)19(33-12-3-4-12)7-17(24)21(20)25)16(10-28-31)11-2-5-13-14(6-11)18(9-27)29-30-23(13)32;/h2,5-7,10,12H,3-4,9,27H2,1H3,(H,30,32);1H |
| InChIKey | DZPMMIVKBCBPMC-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC3=C(C=C2)C(=O)NN=C3CN)C4=C(C(=CC(=C4F)Cl)OC5CC5)C#N.Cl |
| Reference | [1]. Targeting the genetic and immunological drivers of cancer. |
