For research use only. Not for therapeutic Use.
MS 245 oxalate (Cat No.:I010912) is a chemical compound that acts as an inhibitor of ubiquitin-specific protease 2 (USP2). It selectively targets and inhibits the enzymatic activity of USP2, leading to increased protein ubiquitination and degradation. This inhibition has the potential to impact various cellular processes regulated by protein ubiquitination, such as cell cycle control and DNA repair. MS 245 oxalate is being investigated for its therapeutic potential in diseases associated with dysregulated protein ubiquitination, including cancer.
CAS Number | 275363-58-1 |
Synonyms | 5-Methoxy-N,N-dimethyl-1-(phenylsulfonyl)-1H-indole-3-ethanamine oxalate |
Molecular Formula | C21H24N2O7S |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble to 50 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 2-[1-(benzenesulfonyl)-5-methoxyindol-3-yl]-N,N-dimethylethanamine;oxalic acid |
InChI | InChI=1S/C19H22N2O3S.C2H2O4/c1-20(2)12-11-15-14-21(19-10-9-16(24-3)13-18(15)19)25(22,23)17-7-5-4-6-8-17;3-1(4)2(5)6/h4-10,13-14H,11-12H2,1-3H3;(H,3,4)(H,5,6) |
InChIKey | BLSWAEGCRSFTJG-UHFFFAOYSA-N |
SMILES | CN(C)CCC1=CN(C2=C1C=C(C=C2)OC)S(=O)(=O)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |