For research use only. Not for therapeutic Use.
MS0015203（Cat No.:I032799） is a highly potent and selective agonist that specifically activates the neuropeptide receptor GPR171. This compound exhibits strong affinity and efficacy in stimulating GPR171 signaling pathways. By binding and activating GPR171, MS0015203 modulates the physiological and biochemical processes associated with this neuropeptide receptor. Due to its selectivity and potency, MS0015203 serves as a valuable tool compound for investigating the functional roles of GPR171 and exploring its potential as a therapeutic target in various biological systems and disorders.
| Catalog Number | I032799 |
| CAS Number | 73912-52-4 |
| Synonyms | MS0015203; MS-0015203; MS 0015203; |
| Molecular Formula | C12H11NO5 |
| Purity | 98% |
| Target | GPR171 |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | 5-[(2-Methyl-1-oxo-2-propen-1-yl)amino]-1,3-benzenedicarboxylic acid |
| InChI | InChI=1S/C12H11NO5/c1-6(2)10(14)13-9-4-7(11(15)16)3-8(5-9)12(17)18/h3-5H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | NVOBVSWSDYFEMR-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC(NC(C(C)=C)=O)=CC(C(O)=O)=C1)O |
| Reference | 1: Wardman JH, Gomes I, Bobeck EN, Stockert JA, Kapoor A, Bisignano P, Gupta A, Mezei M, Kumar S, Filizola M, Devi LA. Identification of a small-molecule ligand that activates the neuropeptide receptor GPR171 and increases food intake. Sci Signal. 2016 May 31;9(430):ra55. doi: 10.1126/scisignal.aac8035. PubMed PMID: 27245612; PubMed Central PMCID: PMC5150984. |
