For research use only. Not for therapeutic Use.
MS023(CAT: I002371), with the chemical name (S)-N-(5-(2-(4-(1-(R)-ethylpyrrolidine-2-carboxamido)anilino)-4-methylthiazol-5-yl)thiazol-2-yl)pyridine-3-carboxamide, is a potent, selective, and cell-active inhibitor of human type I protein arginine methyltransferases (PRMTs). It exerts its inhibitory action by effectively targeting and binding to the active sites of type I PRMTs. With an IC50 range of 4-119 nM, MS023 demonstrates strong inhibitory effects against these enzymes, thereby potentially impacting various cellular processes that involve protein arginine methylation.
| Catalog Number | I002371 |
| CAS Number | 1831110-54-3 |
| Synonyms | N1-((4-(4-isopropoxyphenyl)-1H-pyrrol-3-yl)methyl)-N1-methylethane-1,2-diamine |
| Molecular Formula | C17H25N3O |
| Purity | ≥95% |
| Target | Histone Methyltransferase |
| Solubility | DMSO: ≥ 30 mg/mL |
| Storage | Store at -20°C |
| IC50 | 4-119 nM |
| InChI | InChI=1S/C17H25N3O/c1-13(2)21-16-6-4-14(5-7-16)17-11-19-10-15(17)12-20(3)9-8-18/h4-7,10-11,13,19H,8-9,12,18H2,1-3H3 |
| InChIKey | FMTVWAGUJRUAKE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C2=CNC=C2CN(C)CCN)C=C1 |
| Reference | <p style=/line-height:25px/> |
