For research use only. Not for therapeutic Use.
MS7972(Cat No.:I008211) is a potent inhibitor of the CREBBP (CREB-binding protein) protein. CREBBP is a transcriptional coactivator involved in regulating gene expression and various cellular processes. By targeting CREBBP, MS7972 can modulate its activity and disrupt its interactions with other proteins, potentially affecting downstream gene expression and cellular functions. As a CREBBP inhibitor, MS7972 may have implications in the field of epigenetics and be explored for its therapeutic potential in diseases where dysregulated gene expression or aberrant CREBBP activity plays a role, such as certain cancers or neurological disorders.
CAS Number | 352553-42-5 |
Synonyms | MS7972; MS-7972; MS 7972.;9-Acetyl-3,4-dihydro-2H-carbazol-1-one |
Molecular Formula | C14H13NO2 |
Purity | ≥95% |
Target | MDM-2/p53 |
Solubility | Soluble in DMSO, not in water |
Storage | Store at -20°C |
IUPAC Name | 9-acetyl-3,4-dihydro-2H-carbazol-1-one |
InChI | InChI=1S/C14H13NO2/c1-9(16)15-12-7-3-2-5-10(12)11-6-4-8-13(17)14(11)15/h2-3,5,7H,4,6,8H2,1H3 |
InChIKey | MIGJEXKBUJPKJF-UHFFFAOYSA-N |
SMILES | CC(=O)N1C2=CC=CC=C2C3=C1C(=O)CCC3 |
Reference | </br>Gacias, M.; Gerona-Navarro, G.; Plotnikov, A. N.; Zhang, G.; Zeng, L.; Kaur, J.; Moy, G.; Rusinova, E.; Rodriguez, Y.; Matikainen, B.; Vincek, A.; Joshua, J.; Casaccia, P.; Zhou, M. M. Selective chemical modulation of gene transcription favors oligodendrocyte lineage progression. Chem. Biol. 2014, 21, 841−854. |