For research use only. Not for therapeutic Use.
MSAB (Mesoderm-Specific Arsenic-Binding Protein) is a protein involved in cellular processes such as differentiation and migration during mesoderm formation. It plays a key role in embryonic development, particularly in the cardiovascular and skeletal systems. Research on MSAB has expanded into its potential role in disease mechanisms, including cancer and heart disease, due to its interaction with arsenic compounds, which may influence cellular signaling pathways. MSAB is also a subject of interest for studying stress responses and cell survival.
| Catalog Number | I011959 |
| CAS Number | 173436-66-3 |
| Synonyms | MSAB;;Methyl 3-{[(4-methylphenyl)sulfonyl]amino}benzoate |
| Molecular Formula | C15H15NO4S |
| Purity | ≥95% |
| Target | Wnt/β-catenin signaling inhibitor |
| Solubility | Soluble in DMSO |
| Storage | Store at 0-8 °C |
| IUPAC Name | methyl 3-[(4-methylphenyl)sulfonylamino]benzoate |
| InChI | InChI=1S/C15H15NO4S/c1-11-6-8-14(9-7-11)21(18,19)16-13-5-3-4-12(10-13)15(17)20-2/h3-10,16H,1-2H3 |
| InChIKey | CVKBYFCJQSPBOI-UHFFFAOYSA-N |
| SMILES | O=C(OC)C1=CC=CC(NS(=O)(C2=CC=C(C)C=C2)=O)=C1 |
