For research use only. Not for therapeutic Use.
MSP-3 (Cat No.:I011961) is a key protein expressed on the surface of Plasmodium falciparum merozoites, the stage of the malaria parasite responsible for invading red blood cells. It plays a critical role in parasite development and immune evasion, making it a promising target for malaria vaccine development. MSP-3 elicits strong immune responses, particularly antibody-dependent cellular inhibition (ADCI), which helps control parasite replication. Recombinant MSP-3 has been investigated in clinical trials as a vaccine candidate, aiming to induce protective immunity and reduce the severity and spread of malaria infections in endemic regions.
| CAS Number | 1820968-63-5 |
| Synonyms | N-[(4-hydroxy-3-methoxyphenyl)methyl]-4-thiophen-2-ylbutanamide |
| Molecular Formula | C16H19NO3S |
| Purity | ≥95% |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-4-thiophen-2-ylbutanamide |
| InChI | InChI=1S/C16H19NO3S/c1-20-15-10-12(7-8-14(15)18)11-17-16(19)6-2-4-13-5-3-9-21-13/h3,5,7-10,18H,2,4,6,11H2,1H3,(H,17,19) |
| InChIKey | HCUVEUVIUAJXRB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CNC(=O)CCCC2=CC=CS2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
