For research use only. Not for therapeutic Use.
MSX-130 (CAT: I014487) is a potent CXCR4 antagonist, exhibiting the ability to selectively block the chemokine receptor CXCR4. CXCR4 is known to play a crucial role in various physiological processes, including immune cell trafficking, hematopoiesis, and tissue development. By antagonizing CXCR4, MSX-130 has the potential to modulate immune responses and influence cell migration, making it a valuable candidate for therapeutic interventions in conditions where CXCR4-mediated signaling is implicated.
CAS Number | 4051-59-6 |
Synonyms | MSX-130; MSX 130; MSX130.;2,2′-(1,4-Phenylene)bis[4,5-diphenyl-1H-imidazole] |
Molecular Formula | C36H26N4 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | Soluble in DMSO |
InChI | InChI=1S/C36H26N4/c1-5-13-25(14-6-1)31-32(26-15-7-2-8-16-26)38-35(37-31)29-21-23-30(24-22-29)36-39-33(27-17-9-3-10-18-27)34(40-36)28-19-11-4-12-20-28/h1-24H,(H,37,38)(H,39,40) |
InChIKey | MKRQQXYFSWSAIS-UHFFFAOYSA-N |
SMILES | C1(C2=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N2)=CC=C(C5=NC(C6=CC=CC=C6)=C(C7=CC=CC=C7)N5)C=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |