For research use only. Not for therapeutic Use.
MT63-78（Cat No.:I015081） is a potent AMP-activated protein kinase (AMPK) activator, with an EC50 of 25 μM. It not only activates AMPK but also induces mitotic arrest and apoptosis. MT63-78 exhibits anti-tumor effects by inhibiting adipogenesis and the mTORC1 pathway, thereby preventing prostate cancer growth. This compound holds promise as a potential therapeutic agent due to its ability to activate AMPK, regulate cell cycle progression, and inhibit tumor-associated pathways.
| Catalog Number | I015081 |
| CAS Number | 1179347-65-9 |
| Molecular Formula | C₂₁H₁₄N₂O₂ |
| Purity | ≥95% |
| Target | PI3K/Akt/mTOR |
| Storage | 4°C, protect from light |
| IUPAC Name | 5-[4-(2,6-dihydroxyphenyl)phenyl]-1H-indole-3-carbonitrile |
| InChI | InChI=1S/C21H14N2O2/c22-11-16-12-23-18-9-8-15(10-17(16)18)13-4-6-14(7-5-13)21-19(24)2-1-3-20(21)25/h1-10,12,23-25H |
| InChIKey | IGSYZPLXAFVMKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C2=CC=C(C=C2)C3=CC4=C(C=C3)NC=C4C#N)O |
| Reference | [1]. Zadra G, et al. A novel direct activator of AMPK inhibits prostate cancer growth by blocking lipogenesis. EMBO Mol Med. 2014 Apr;6(4):519-38. |
