For research use only. Not for therapeutic Use.
MTT (Cat No.: I011139) is a widely utilized cell-permeable reagent with a positive charge. It plays a crucial role in various cellular assays, particularly in assessing cell metabolism, proliferation, cytotoxicity, and apoptosis. In living cells, MTT is reduced, causing a color change from yellow to purple formazan. This colorimetric reaction provides valuable insights into cellular activities, making MTT an indispensable tool for researchers in fields like cell biology, drug discovery, and toxicology.
| Catalog Number | I011139 |
| CAS Number | 298-93-1 |
| Synonyms | 3-(4,5-Dimethyl-2-thiazolyl)-2,5-diphenyl-2H-tetrazolium bromide |
| Molecular Formula | C18H16N5SBr |
| Purity | ≥95% |
| Target | Reagents |
| Solubility | Soluble to 20 mM in water |
| Storage | 2-8°C |
| IUPAC Name | 2-(3,5-diphenyltetrazol-2-ium-2-yl)-4,5-dimethyl-1,3-thiazole;bromide |
| InChI | InChI=1S/C18H16N5S.BrH/c1-13-14(2)24-18(19-13)23-21-17(15-9-5-3-6-10-15)20-22(23)16-11-7-4-8-12-16;/h3-12H,1-2H3;1H/q+1;/p-1 |
| InChIKey | AZKSAVLVSZKNRD-UHFFFAOYSA-M |
| SMILES | CC1=C(SC(=N1)[N+]2=NC(=NN2C3=CC=CC=C3)C4=CC=CC=C4)C.[Br-] |
