For research use only. Not for therapeutic Use.
Mulberrin is a natural flavonoid compound found in mulberries (Morus species). It exhibits various biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Mulberrin is studied for its potential health benefits, such as protecting against oxidative stress, reducing inflammation, and supporting overall wellness. Research focuses on its pharmacological effects, mechanisms of action, and potential therapeutic applications in preventing and managing chronic diseases, particularly those related to oxidative damage and inflammation.
| Catalog Number | R048391 |
| CAS Number | 62949-79-5 |
| Molecular Formula | C25H26O6 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20 ℃ |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methylbut-2-enyl)chromen-4-one |
| InChI | InChI=1S/C25H26O6/c1-13(2)5-8-17-20(28)12-21(29)22-23(30)18(9-6-14(3)4)24(31-25(17)22)16-10-7-15(26)11-19(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| InChIKey | UWQYBLOHTQWSQD-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(=C(C2=O)CC=C(C)C)C3=C(C=C(C=C3)O)O)O)O)C |
