For research use only. Not for therapeutic Use.
Mulberroside A (Cat.No:I000177) is a natural compound isolated from the root bark of the mulberry tree (Morus alba). It belongs to the class of flavonoid glycosides and exhibits various biological activities, including antioxidant, anti-inflammatory, and anticancer properties. Mulberroside A has shown potential in preclinical studies for its ability to inhibit tumor growth and protect against oxidative stress. Further research is underway to explore its therapeutic applications.
| Catalog Number | I000177 |
| CAS Number | 102841-42-9 |
| Molecular Formula | C26H32O14 |
| Purity | 98% |
| Solubility | DMSO: 40 mg/mL |
| Appearance | Powder |
| Storage | Store at -20°C |
| IC50 | 1.29 μmol/L (inhibition of the monophenolase activity); KI value: 0.385 μmol/L (the inhibition constant of the effectors on tyrosinase); KIS value: 0.177 μmol/L (the inhibition constant of the enzyme-substrate complex) [3] |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-hydroxy-4-[(E)-2-[3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C26H32O14/c27-9-17-19(31)21(33)23(35)25(39-17)37-14-4-3-12(16(30)8-14)2-1-11-5-13(29)7-15(6-11)38-26-24(36)22(34)20(32)18(10-28)40-26/h1-8,17-36H,9-10H2/b2-1+/t17-,18-,19-,20-,21+,22+,23-,24-,25-,26-/m1/s1 |
| InChIKey | HPSWAEGGWLOOKT-VUNDNAJOSA-N |
| SMILES | C1=CC(=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)O)C=CC3=CC(=CC(=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
| Reference | <p style=”/line-height:25px/”> |
