For research use only. Not for therapeutic Use.
Multicaulisin（Cat No.:R072620）is a natural chalcone isolated from Tephrosia species, known for its potent bioactive properties, including antimicrobial, anticancer, and anti-inflammatory effects. This compound exhibits cytotoxicity against various cancer cell lines, making it a valuable candidate for cancer research and drug development. Multicaulisin’s structure, featuring a distinct chalcone backbone, contributes to its ability to inhibit enzymes and signaling pathways involved in disease progression. As a research compound, Multicaulisin holds promise for studying therapeutic approaches targeting microbial infections and inflammatory conditions, expanding possibilities in pharmaceutical research.
| Catalog Number | R072620 |
| CAS Number | 286461-76-5 |
| Molecular Formula | C40H36O11 |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | 6-[(1R,5S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]-2-(2,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| InChI | InChI=1S/C40H36O11/c1-19(2)4-3-5-20-12-27(24-9-6-21(41)14-29(24)44)36(39(49)26-11-8-23(43)16-31(26)46)28(13-20)37-32(47)18-35-38(40(37)50)33(48)17-34(51-35)25-10-7-22(42)15-30(25)45/h4,6-11,13-18,27-28,36,41-47,50H,3,5,12H2,1-2H3/t27-,28-,36-/m1/s1 |
| InChIKey | IRBDNXPVYAEOSW-IKXMMLORSA-N |
| SMILES | CC(=CCCC1=C[C@H]([C@@H]([C@H](C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=C(C=C(C=C6)O)O)O)C |
| Reference | 1.<span style=”font-family: Arial, sans-serif; font-size: 13px;”>Ferrari, F., et al. "Multicaulisin, a new Diels-Alder type adduct from Morus multicaulis." </span><i style=”font-family: Arial, sans-serif; font-size: 13px;”>Fitoterapia</i><span style=”font-family: Arial, sans-serif; font-size: 13px;”> 71.2 (2000): 213-215.</span> |
